C20H23BrN4O9S — CID 162657725
2-[N-(2-bromoethyl)-2-(2-hydroxyethylcarbamoyl)-4,6-dinitroanilino]ethyl 4-methylbenzenesulfonate (PubChem CID 162657725) has the molecular formula C20H23BrN4O9S and a molecular weight of 575.39 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-2-(2-hydroxyethylcarbamoyl)-4,6-dinitroanilino]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-2-(2-hydroxyethylcarbamoyl)-4,6-dinitroanilino]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162657725 |
| Molecular Formula | C20H23BrN4O9S |
| Molecular Weight | 575.39 g/mol |
| Exact Mass | 574.04 |
| IUPAC Name | 2-[N-(2-bromoethyl)-2-(2-hydroxyethylcarbamoyl)-4,6-dinitroanilino]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCN(CCBr)c2c(C(=O)NCCO)cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H23BrN4O9S/c1-14-2-4-16(5-3-14)35(32,33)34-11-9-23(8-6-21)19-17(20(27)22-7-10-26)12-15(24(28)29)13-18(19)25(30)31/h2-5,12-13,26H,6-11H2,1H3,(H,22,27) |
| InChIKey | SEXHDEOTURTEQN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 182.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|