C28H37BrN4O18S — CID 59325913
[3,4,5-triacetyloxy-6-[2-[[2-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-3,5-dinitrobenzoyl]amino]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 59325913) has the molecular formula C28H37BrN4O18S and a molecular weight of 829.58 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[2-[[2-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-3,5-dinitrobenzoyl]amino]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[2-[[2-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-3,5-dinitrobenzoyl]amino]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59325913 |
| Molecular Formula | C28H37BrN4O18S |
| Molecular Weight | 829.58 g/mol |
| Exact Mass | 828.10 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[2-[[2-[2-bromoethyl(2-methylsulfonyloxyethyl)amino]-3,5-dinitrobenzoyl]amino]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OCCNC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2N(CCBr)CCOS(C)(=O)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C28H37BrN4O18S/c1-15(34)46-14-22-24(48-16(2)35)25(49-17(3)36)26(50-18(4)37)28(51-22)45-10-7-30-27(38)20-12-19(32(39)40)13-21(33(41)42)23(20)31(8-6-29)9-11-47-52(5,43)44/h12-13,22,24-26,28H,6-11,14H2,1-5H3,(H,30,38) |
| InChIKey | QJHHGGYXFWUZCC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 285.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.58 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|