C20H29BrN4O14S — CID 59325918
2-[N-(2-bromoethyl)-2,4-dinitro-6-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylcarbamoyl]anilino]ethyl methanesulfonate (PubChem CID 59325918) has the molecular formula C20H29BrN4O14S and a molecular weight of 661.44 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-2,4-dinitro-6-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylcarbamoyl]anilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-2,4-dinitro-6-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylcarbamoyl]anilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 59325918 |
| Molecular Formula | C20H29BrN4O14S |
| Molecular Weight | 661.44 g/mol |
| Exact Mass | 660.06 |
| IUPAC Name | 2-[N-(2-bromoethyl)-2,4-dinitro-6-[2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethylcarbamoyl]anilino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN(CCBr)c1c(C(=O)NCCOC2OC(CO)C(O)C(O)C2O)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H29BrN4O14S/c1-40(35,36)38-7-5-23(4-2-21)15-12(8-11(24(31)32)9-13(15)25(33)34)19(30)22-3-6-37-20-18(29)17(28)16(27)14(10-26)39-20/h8-9,14,16-18,20,26-29H,2-7,10H2,1H3,(H,22,30) |
| InChIKey | ATIKDTNINCHADL-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 261.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.44 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|