C15H22BrN5O9S2 — CID 150116976
2-[N-(2-bromoethyl)-2,4-dinitro-6-piperazin-1-ylsulfonylanilino]ethyl methanesulfonate (PubChem CID 150116976) has the molecular formula C15H22BrN5O9S2 and a molecular weight of 560.41 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-2,4-dinitro-6-piperazin-1-ylsulfonylanilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-2,4-dinitro-6-piperazin-1-ylsulfonylanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 150116976 |
| Molecular Formula | C15H22BrN5O9S2 |
| Molecular Weight | 560.41 g/mol |
| Exact Mass | 559.00 |
| IUPAC Name | 2-[N-(2-bromoethyl)-2,4-dinitro-6-piperazin-1-ylsulfonylanilino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN(CCBr)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1S(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C15H22BrN5O9S2/c1-31(26,27)30-9-8-18(5-2-16)15-13(21(24)25)10-12(20(22)23)11-14(15)32(28,29)19-6-3-17-4-7-19/h10-11,17H,2-9H2,1H3 |
| InChIKey | DYLHBOMAEKUCFK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 182.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.41 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|