C14H19Cl2N3O6S — CID 90043079
5-[bis(2-chloroethyl)amino]-N-(2-hydroxyethyl)-4-methylsulfonyl-2-nitrobenzamide (PubChem CID 90043079) has the molecular formula C14H19Cl2N3O6S and a molecular weight of 428.29 g/mol. Its IUPAC name is 5-[bis(2-chloroethyl)amino]-N-(2-hydroxyethyl)-4-methylsulfonyl-2-nitrobenzamide.
| Compound Name | 5-[bis(2-chloroethyl)amino]-N-(2-hydroxyethyl)-4-methylsulfonyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 90043079 |
| Molecular Formula | C14H19Cl2N3O6S |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 5-[bis(2-chloroethyl)amino]-N-(2-hydroxyethyl)-4-methylsulfonyl-2-nitrobenzamide |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(C(=O)NCCO)cc1N(CCCl)CCCl |
| InChI | InChI=1S/C14H19Cl2N3O6S/c1-26(24,25)13-9-11(19(22)23)10(14(21)17-4-7-20)8-12(13)18(5-2-15)6-3-16/h8-9,20H,2-7H2,1H3,(H,17,21) |
| InChIKey | JZHJHMVJHMAAEI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|