C20H28BrN5O7S — CID 90043910
2-[N-(2-bromoethyl)-2-cyano-5-(3-morpholin-4-ylpropylcarbamoyl)-4-nitroanilino]ethyl methanesulfonate (PubChem CID 90043910) has the molecular formula C20H28BrN5O7S and a molecular weight of 562.44 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-2-cyano-5-(3-morpholin-4-ylpropylcarbamoyl)-4-nitroanilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-2-cyano-5-(3-morpholin-4-ylpropylcarbamoyl)-4-nitroanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 90043910 |
| Molecular Formula | C20H28BrN5O7S |
| Molecular Weight | 562.44 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | 2-[N-(2-bromoethyl)-2-cyano-5-(3-morpholin-4-ylpropylcarbamoyl)-4-nitroanilino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN(CCBr)c1cc(C(=O)NCCCN2CCOCC2)c([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C20H28BrN5O7S/c1-34(30,31)33-12-9-25(6-3-21)18-14-17(19(26(28)29)13-16(18)15-22)20(27)23-4-2-5-24-7-10-32-11-8-24/h13-14H,2-12H2,1H3,(H,23,27) |
| InChIKey | VBONGLJGFHIHHR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 155.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|