C20H29BrN4O8S2 — CID 156676600
2-[N-(2-bromoethyl)-2-ethynyl-6-[methyl(2-morpholin-4-ylethyl)sulfamoyl]-4-nitroanilino]ethyl methanesulfonate (PubChem CID 156676600) has the molecular formula C20H29BrN4O8S2 and a molecular weight of 597.51 g/mol. Its IUPAC name is 2-[N-(2-bromoethyl)-2-ethynyl-6-[methyl(2-morpholin-4-ylethyl)sulfamoyl]-4-nitroanilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-bromoethyl)-2-ethynyl-6-[methyl(2-morpholin-4-ylethyl)sulfamoyl]-4-nitroanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 156676600 |
| Molecular Formula | C20H29BrN4O8S2 |
| Molecular Weight | 597.51 g/mol |
| Exact Mass | 596.06 |
| IUPAC Name | 2-[N-(2-bromoethyl)-2-ethynyl-6-[methyl(2-morpholin-4-ylethyl)sulfamoyl]-4-nitroanilino]ethyl methanesulfonate |
| SMILES | C#Cc1cc([N+](=O)[O-])cc(S(=O)(=O)N(C)CCN2CCOCC2)c1N(CCBr)CCOS(C)(=O)=O |
| InChI | InChI=1S/C20H29BrN4O8S2/c1-4-17-15-18(25(26)27)16-19(20(17)24(6-5-21)11-14-33-34(3,28)29)35(30,31)22(2)7-8-23-9-12-32-13-10-23/h1,15-16H,5-14H2,2-3H3 |
| InChIKey | CMWHUJHQKHFJHH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 139.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.51 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|