C20H34N4O8S2 — CID 159050791
2-[2-methyl-6-[methyl(2-morpholin-4-ylethyl)sulfamoyl]-4-nitro-N-propylanilino]ethyl methanesulfonate (PubChem CID 159050791) has the molecular formula C20H34N4O8S2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 2-[2-methyl-6-[methyl(2-morpholin-4-ylethyl)sulfamoyl]-4-nitro-N-propylanilino]ethyl methanesulfonate.
| Compound Name | 2-[2-methyl-6-[methyl(2-morpholin-4-ylethyl)sulfamoyl]-4-nitro-N-propylanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 159050791 |
| Molecular Formula | C20H34N4O8S2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 2-[2-methyl-6-[methyl(2-morpholin-4-ylethyl)sulfamoyl]-4-nitro-N-propylanilino]ethyl methanesulfonate |
| SMILES | CCCN(CCOS(C)(=O)=O)c1c(C)cc([N+](=O)[O-])cc1S(=O)(=O)N(C)CCN1CCOCC1 |
| InChI | InChI=1S/C20H34N4O8S2/c1-5-6-23(11-14-32-33(4,27)28)20-17(2)15-18(24(25)26)16-19(20)34(29,30)21(3)7-8-22-9-12-31-13-10-22/h15-16H,5-14H2,1-4H3 |
| InChIKey | JMVZPNFWQSMHFL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 139.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|