C16H19Br2N3O5S — CID 156676449
N,N-bis(2-bromoethyl)-2-ethynyl-6-morpholin-4-ylsulfonyl-4-nitroaniline (PubChem CID 156676449) has the molecular formula C16H19Br2N3O5S and a molecular weight of 525.22 g/mol. Its IUPAC name is N,N-bis(2-bromoethyl)-2-ethynyl-6-morpholin-4-ylsulfonyl-4-nitroaniline.
| Compound Name | N,N-bis(2-bromoethyl)-2-ethynyl-6-morpholin-4-ylsulfonyl-4-nitroaniline |
|---|---|
| PubChem CID | 156676449 |
| Molecular Formula | C16H19Br2N3O5S |
| Molecular Weight | 525.22 g/mol |
| Exact Mass | 522.94 |
| IUPAC Name | N,N-bis(2-bromoethyl)-2-ethynyl-6-morpholin-4-ylsulfonyl-4-nitroaniline |
| SMILES | C#Cc1cc([N+](=O)[O-])cc(S(=O)(=O)N2CCOCC2)c1N(CCBr)CCBr |
| InChI | InChI=1S/C16H19Br2N3O5S/c1-2-13-11-14(21(22)23)12-15(16(13)19(5-3-17)6-4-18)27(24,25)20-7-9-26-10-8-20/h1,11-12H,3-10H2 |
| InChIKey | WLHATWDUQDPGLK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|