C14H16BrN3O5S — CID 170353120
N-(2-bromoethyl)-N-ethynyl-2-morpholin-4-ylsulfonyl-4-nitroaniline (PubChem CID 170353120) has the molecular formula C14H16BrN3O5S and a molecular weight of 418.27 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-ethynyl-2-morpholin-4-ylsulfonyl-4-nitroaniline.
| Compound Name | N-(2-bromoethyl)-N-ethynyl-2-morpholin-4-ylsulfonyl-4-nitroaniline |
|---|---|
| PubChem CID | 170353120 |
| Molecular Formula | C14H16BrN3O5S |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | N-(2-bromoethyl)-N-ethynyl-2-morpholin-4-ylsulfonyl-4-nitroaniline |
| SMILES | C#CN(CCBr)c1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H16BrN3O5S/c1-2-16(6-5-15)13-4-3-12(18(19)20)11-14(13)24(21,22)17-7-9-23-10-8-17/h1,3-4,11H,5-10H2 |
| InChIKey | FSHRCLRNIRBKMF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|