C18H20Br2N4O4S — CID 156676530
N,N-bis(2-bromoethyl)-2-(6,8-dihydro-5H-1,7-naphthyridin-7-ylsulfonyl)-4-nitroaniline (PubChem CID 156676530) has the molecular formula C18H20Br2N4O4S and a molecular weight of 548.26 g/mol. Its IUPAC name is N,N-bis(2-bromoethyl)-2-(6,8-dihydro-5H-1,7-naphthyridin-7-ylsulfonyl)-4-nitroaniline.
| Compound Name | N,N-bis(2-bromoethyl)-2-(6,8-dihydro-5H-1,7-naphthyridin-7-ylsulfonyl)-4-nitroaniline |
|---|---|
| PubChem CID | 156676530 |
| Molecular Formula | C18H20Br2N4O4S |
| Molecular Weight | 548.26 g/mol |
| Exact Mass | 545.96 |
| IUPAC Name | N,N-bis(2-bromoethyl)-2-(6,8-dihydro-5H-1,7-naphthyridin-7-ylsulfonyl)-4-nitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N(CCBr)CCBr)c(S(=O)(=O)N2CCc3cccnc3C2)c1 |
| InChI | InChI=1S/C18H20Br2N4O4S/c19-6-10-22(11-7-20)17-4-3-15(24(25)26)12-18(17)29(27,28)23-9-5-14-2-1-8-21-16(14)13-23/h1-4,8,12H,5-7,9-11,13H2 |
| InChIKey | WZWCJTIWTGSWRT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|