C21H27N3O7S2 — CID 158338677
2-[2-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-4-nitro-N-propylanilino]ethyl methanesulfonate (PubChem CID 158338677) has the molecular formula C21H27N3O7S2 and a molecular weight of 497.60 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-4-nitro-N-propylanilino]ethyl methanesulfonate.
| Compound Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-4-nitro-N-propylanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 158338677 |
| Molecular Formula | C21H27N3O7S2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-4-nitro-N-propylanilino]ethyl methanesulfonate |
| SMILES | CCCN(CCOS(C)(=O)=O)c1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H27N3O7S2/c1-3-11-22(13-14-31-32(2,27)28)20-9-8-19(24(25)26)15-21(20)33(29,30)23-12-10-17-6-4-5-7-18(17)16-23/h4-9,15H,3,10-14,16H2,1-2H3 |
| InChIKey | SXWIHLBSHMKYTN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|