C19H32N4O13S4 — CID 175069889
1-[4-[2-[bis(2-methylsulfonyloxyethyl)amino]-5-nitrophenyl]sulfonylpiperazin-1-yl]propane-1-sulfonic acid (PubChem CID 175069889) has the molecular formula C19H32N4O13S4 and a molecular weight of 652.75 g/mol. Its IUPAC name is 1-[4-[2-[bis(2-methylsulfonyloxyethyl)amino]-5-nitrophenyl]sulfonylpiperazin-1-yl]propane-1-sulfonic acid.
| Compound Name | 1-[4-[2-[bis(2-methylsulfonyloxyethyl)amino]-5-nitrophenyl]sulfonylpiperazin-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 175069889 |
| Molecular Formula | C19H32N4O13S4 |
| Molecular Weight | 652.75 g/mol |
| Exact Mass | 652.08 |
| IUPAC Name | 1-[4-[2-[bis(2-methylsulfonyloxyethyl)amino]-5-nitrophenyl]sulfonylpiperazin-1-yl]propane-1-sulfonic acid |
| SMILES | CCC(N1CCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2N(CCOS(C)(=O)=O)CCOS(C)(=O)=O)CC1)S(=O)(=O)O |
| InChI | InChI=1S/C19H32N4O13S4/c1-4-19(40(32,33)34)21-7-9-22(10-8-21)39(30,31)18-15-16(23(24)25)5-6-17(18)20(11-13-35-37(2,26)27)12-14-36-38(3,28)29/h5-6,15,19H,4,7-14H2,1-3H3,(H,32,33,34) |
| InChIKey | ZPDKPQPBOUFCQM-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 228.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.75 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|