C20H24Br2N4O4S — CID 156676471
N,N-bis(2-bromoethyl)-4-nitro-2-(4-phenylpiperazin-1-yl)sulfonylaniline (PubChem CID 156676471) has the molecular formula C20H24Br2N4O4S and a molecular weight of 576.31 g/mol. Its IUPAC name is N,N-bis(2-bromoethyl)-4-nitro-2-(4-phenylpiperazin-1-yl)sulfonylaniline.
| Compound Name | N,N-bis(2-bromoethyl)-4-nitro-2-(4-phenylpiperazin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 156676471 |
| Molecular Formula | C20H24Br2N4O4S |
| Molecular Weight | 576.31 g/mol |
| Exact Mass | 573.99 |
| IUPAC Name | N,N-bis(2-bromoethyl)-4-nitro-2-(4-phenylpiperazin-1-yl)sulfonylaniline |
| SMILES | O=[N+]([O-])c1ccc(N(CCBr)CCBr)c(S(=O)(=O)N2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H24Br2N4O4S/c21-8-10-24(11-9-22)19-7-6-18(26(27)28)16-20(19)31(29,30)25-14-12-23(13-15-25)17-4-2-1-3-5-17/h1-7,16H,8-15H2 |
| InChIKey | RDCMVCIRUBCFCV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|