C16H19N5O4S — CID 133307727
N-methyl-4-nitro-N-(pyrazin-2-ylmethyl)-2-pyrrolidin-1-ylsulfonylaniline (PubChem CID 133307727) has the molecular formula C16H19N5O4S and a molecular weight of 377.43 g/mol. Its IUPAC name is N-methyl-4-nitro-N-(pyrazin-2-ylmethyl)-2-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-methyl-4-nitro-N-(pyrazin-2-ylmethyl)-2-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 133307727 |
| Molecular Formula | C16H19N5O4S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-methyl-4-nitro-N-(pyrazin-2-ylmethyl)-2-pyrrolidin-1-ylsulfonylaniline |
| SMILES | CN(Cc1cnccn1)c1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C16H19N5O4S/c1-19(12-13-11-17-6-7-18-13)15-5-4-14(21(22)23)10-16(15)26(24,25)20-8-2-3-9-20/h4-7,10-11H,2-3,8-9,12H2,1H3 |
| InChIKey | OQUQRKXMMAUSCQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 109.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|