C18H19ClFN3O5S — CID 4820104
N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-morpholin-4-ylsulfonyl-4-nitroaniline (PubChem CID 4820104) has the molecular formula C18H19ClFN3O5S and a molecular weight of 443.88 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-morpholin-4-ylsulfonyl-4-nitroaniline.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-morpholin-4-ylsulfonyl-4-nitroaniline |
|---|---|
| PubChem CID | 4820104 |
| Molecular Formula | C18H19ClFN3O5S |
| Molecular Weight | 443.88 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-morpholin-4-ylsulfonyl-4-nitroaniline |
| SMILES | CN(Cc1c(F)cccc1Cl)c1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H19ClFN3O5S/c1-21(12-14-15(19)3-2-4-16(14)20)17-6-5-13(23(24)25)11-18(17)29(26,27)22-7-9-28-10-8-22/h2-6,11H,7-10,12H2,1H3 |
| InChIKey | MWGPEISYUYPWLT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.88 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|