C21H23ClFN3O5S — CID 31181703
N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 31181703) has the molecular formula C21H23ClFN3O5S and a molecular weight of 483.95 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 31181703 |
| Molecular Formula | C21H23ClFN3O5S |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-1-(2-methyl-5-nitrophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCC(C(=O)N(C)Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C21H23ClFN3O5S/c1-14-6-7-16(26(28)29)12-20(14)32(30,31)25-10-8-15(9-11-25)21(27)24(2)13-17-18(22)4-3-5-19(17)23/h3-7,12,15H,8-11,13H2,1-2H3 |
| InChIKey | XZNOREDETINLOR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|