C18H24F3N3O5S — CID 55661948
1-(2-methyl-5-nitrophenyl)sulfonyl-N-propyl-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide (PubChem CID 55661948) has the molecular formula C18H24F3N3O5S and a molecular weight of 451.47 g/mol. Its IUPAC name is 1-(2-methyl-5-nitrophenyl)sulfonyl-N-propyl-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide.
| Compound Name | 1-(2-methyl-5-nitrophenyl)sulfonyl-N-propyl-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55661948 |
| Molecular Formula | C18H24F3N3O5S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 1-(2-methyl-5-nitrophenyl)sulfonyl-N-propyl-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
| SMILES | CCCN(CC(F)(F)F)C(=O)C1CCN(S(=O)(=O)c2cc([N+](=O)[O-])ccc2C)CC1 |
| InChI | InChI=1S/C18H24F3N3O5S/c1-3-8-22(12-18(19,20)21)17(25)14-6-9-23(10-7-14)30(28,29)16-11-15(24(26)27)5-4-13(16)2/h4-5,11,14H,3,6-10,12H2,1-2H3 |
| InChIKey | LPJGNKHYECKIEW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|