C16H20N4O4S2 — CID 133308611
N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline (PubChem CID 133308611) has the molecular formula C16H20N4O4S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 133308611 |
| Molecular Formula | C16H20N4O4S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]-4-nitro-2-pyrrolidin-1-ylsulfonylaniline |
| SMILES | Cc1csc(CN(C)c2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCCC2)n1 |
| InChI | InChI=1S/C16H20N4O4S2/c1-12-11-25-16(17-12)10-18(2)14-6-5-13(20(21)22)9-15(14)26(23,24)19-7-3-4-8-19/h5-6,9,11H,3-4,7-8,10H2,1-2H3 |
| InChIKey | YKCXEQMXZDWWBO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|