C18H24N4O4S2 — CID 133274866
4-(azepan-1-ylsulfonyl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-nitroaniline (PubChem CID 133274866) has the molecular formula C18H24N4O4S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-nitroaniline.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-nitroaniline |
|---|---|
| PubChem CID | 133274866 |
| Molecular Formula | C18H24N4O4S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-nitroaniline |
| SMILES | Cc1nc(CN(C)c2ccc(S(=O)(=O)N3CCCCCC3)cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C18H24N4O4S2/c1-14-19-15(13-27-14)12-20(2)17-8-7-16(11-18(17)22(23)24)28(25,26)21-9-5-3-4-6-10-21/h7-8,11,13H,3-6,9-10,12H2,1-2H3 |
| InChIKey | KFFDTLBBYLVRAS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|