C24H31N5O4S — CID 176780758
2-ethynyl-4-nitro-N,N-dipropyl-6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]sulfonylaniline (PubChem CID 176780758) has the molecular formula C24H31N5O4S and a molecular weight of 485.61 g/mol. Its IUPAC name is 2-ethynyl-4-nitro-N,N-dipropyl-6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]sulfonylaniline.
| Compound Name | 2-ethynyl-4-nitro-N,N-dipropyl-6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]sulfonylaniline |
|---|---|
| PubChem CID | 176780758 |
| Molecular Formula | C24H31N5O4S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 2-ethynyl-4-nitro-N,N-dipropyl-6-[4-(pyridin-2-ylmethyl)piperazin-1-yl]sulfonylaniline |
| SMILES | C#Cc1cc([N+](=O)[O-])cc(S(=O)(=O)N2CCN(Cc3ccccn3)CC2)c1N(CCC)CCC |
| InChI | InChI=1S/C24H31N5O4S/c1-4-11-27(12-5-2)24-20(6-3)17-22(29(30)31)18-23(24)34(32,33)28-15-13-26(14-16-28)19-21-9-7-8-10-25-21/h3,7-10,17-18H,4-5,11-16,19H2,1-2H3 |
| InChIKey | FZYROGVTQRTGEV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 99.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|