C22H28F3N5O7S2 — CID 160737241
2-[4-nitro-N-propyl-2-(4-pyridin-3-ylpiperazin-1-yl)sulfonyl-6-(trifluoromethyl)anilino]ethyl methanesulfonate (PubChem CID 160737241) has the molecular formula C22H28F3N5O7S2 and a molecular weight of 595.62 g/mol. Its IUPAC name is 2-[4-nitro-N-propyl-2-(4-pyridin-3-ylpiperazin-1-yl)sulfonyl-6-(trifluoromethyl)anilino]ethyl methanesulfonate.
| Compound Name | 2-[4-nitro-N-propyl-2-(4-pyridin-3-ylpiperazin-1-yl)sulfonyl-6-(trifluoromethyl)anilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 160737241 |
| Molecular Formula | C22H28F3N5O7S2 |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | 2-[4-nitro-N-propyl-2-(4-pyridin-3-ylpiperazin-1-yl)sulfonyl-6-(trifluoromethyl)anilino]ethyl methanesulfonate |
| SMILES | CCCN(CCOS(C)(=O)=O)c1c(C(F)(F)F)cc([N+](=O)[O-])cc1S(=O)(=O)N1CCN(c2cccnc2)CC1 |
| InChI | InChI=1S/C22H28F3N5O7S2/c1-3-7-28(12-13-37-38(2,33)34)21-19(22(23,24)25)14-18(30(31)32)15-20(21)39(35,36)29-10-8-27(9-11-29)17-5-4-6-26-16-17/h4-6,14-16H,3,7-13H2,1-2H3 |
| InChIKey | WSUOXOVNKKYSDO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 143.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|