C23H29N5O4S — CID 176780749
2-ethynyl-4-nitro-N,N-dipropyl-6-(4-pyridin-2-ylpiperazin-1-yl)sulfonylaniline (PubChem CID 176780749) has the molecular formula C23H29N5O4S and a molecular weight of 471.58 g/mol. Its IUPAC name is 2-ethynyl-4-nitro-N,N-dipropyl-6-(4-pyridin-2-ylpiperazin-1-yl)sulfonylaniline.
| Compound Name | 2-ethynyl-4-nitro-N,N-dipropyl-6-(4-pyridin-2-ylpiperazin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 176780749 |
| Molecular Formula | C23H29N5O4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-ethynyl-4-nitro-N,N-dipropyl-6-(4-pyridin-2-ylpiperazin-1-yl)sulfonylaniline |
| SMILES | C#Cc1cc([N+](=O)[O-])cc(S(=O)(=O)N2CCN(c3ccccn3)CC2)c1N(CCC)CCC |
| InChI | InChI=1S/C23H29N5O4S/c1-4-11-26(12-5-2)23-19(6-3)17-20(28(29)30)18-21(23)33(31,32)27-15-13-25(14-16-27)22-9-7-8-10-24-22/h3,7-10,17-18H,4-5,11-16H2,1-2H3 |
| InChIKey | HVJHWYKUAXTHGJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 99.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|