C15H22IN4O12PS — CID 87543716
2-[N-(2-iodoethyl)-2,4-dinitro-3-(3-phosphonooxypropylcarbamoyl)anilino]ethyl methanesulfonate (PubChem CID 87543716) has the molecular formula C15H22IN4O12PS and a molecular weight of 640.30 g/mol. Its IUPAC name is 2-[N-(2-iodoethyl)-2,4-dinitro-3-(3-phosphonooxypropylcarbamoyl)anilino]ethyl methanesulfonate.
| Compound Name | 2-[N-(2-iodoethyl)-2,4-dinitro-3-(3-phosphonooxypropylcarbamoyl)anilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 87543716 |
| Molecular Formula | C15H22IN4O12PS |
| Molecular Weight | 640.30 g/mol |
| Exact Mass | 639.97 |
| IUPAC Name | 2-[N-(2-iodoethyl)-2,4-dinitro-3-(3-phosphonooxypropylcarbamoyl)anilino]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCN(CCI)c1ccc([N+](=O)[O-])c(C(=O)NCCCOP(=O)(O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H22IN4O12PS/c1-34(29,30)32-10-8-18(7-5-16)12-4-3-11(19(22)23)13(14(12)20(24)25)15(21)17-6-2-9-31-33(26,27)28/h3-4H,2,5-10H2,1H3,(H,17,21)(H2,26,27,28) |
| InChIKey | LGGNXHXSYDUPSG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 228.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|