C14H20BrN4O12PS — CID 87873788
3-[N-(2-bromoethyl)-2,4-dinitro-3-(2-phosphonooxyethylcarbamoyl)anilino]propane-1-sulfonic acid (PubChem CID 87873788) has the molecular formula C14H20BrN4O12PS and a molecular weight of 579.28 g/mol. Its IUPAC name is 3-[N-(2-bromoethyl)-2,4-dinitro-3-(2-phosphonooxyethylcarbamoyl)anilino]propane-1-sulfonic acid.
| Compound Name | 3-[N-(2-bromoethyl)-2,4-dinitro-3-(2-phosphonooxyethylcarbamoyl)anilino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 87873788 |
| Molecular Formula | C14H20BrN4O12PS |
| Molecular Weight | 579.28 g/mol |
| Exact Mass | 577.97 |
| IUPAC Name | 3-[N-(2-bromoethyl)-2,4-dinitro-3-(2-phosphonooxyethylcarbamoyl)anilino]propane-1-sulfonic acid |
| SMILES | O=C(NCCOP(=O)(O)O)c1c([N+](=O)[O-])ccc(N(CCBr)CCCS(=O)(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20BrN4O12PS/c15-4-7-17(6-1-9-33(28,29)30)11-3-2-10(18(21)22)12(13(11)19(23)24)14(20)16-5-8-31-32(25,26)27/h2-3H,1,4-9H2,(H,16,20)(H2,25,26,27)(H,28,29,30) |
| InChIKey | CRIZBGCSMRADPB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 239.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|