C15H25BrN4O7S2 — CID 170353092
3-[N-(2-bromoethyl)-2-[2-(dimethylamino)ethylsulfamoyl]-4-nitroanilino]propane-1-sulfonic acid (PubChem CID 170353092) has the molecular formula C15H25BrN4O7S2 and a molecular weight of 517.42 g/mol. Its IUPAC name is 3-[N-(2-bromoethyl)-2-[2-(dimethylamino)ethylsulfamoyl]-4-nitroanilino]propane-1-sulfonic acid.
| Compound Name | 3-[N-(2-bromoethyl)-2-[2-(dimethylamino)ethylsulfamoyl]-4-nitroanilino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 170353092 |
| Molecular Formula | C15H25BrN4O7S2 |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 516.03 |
| IUPAC Name | 3-[N-(2-bromoethyl)-2-[2-(dimethylamino)ethylsulfamoyl]-4-nitroanilino]propane-1-sulfonic acid |
| SMILES | CN(C)CCNS(=O)(=O)c1cc([N+](=O)[O-])ccc1N(CCBr)CCCS(=O)(=O)O |
| InChI | InChI=1S/C15H25BrN4O7S2/c1-18(2)10-7-17-29(26,27)15-12-13(20(21)22)4-5-14(15)19(9-6-16)8-3-11-28(23,24)25/h4-5,12,17H,3,6-11H2,1-2H3,(H,23,24,25) |
| InChIKey | WPZJXAYFCZZNFB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 150.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|