C15H20AsClN3O9S — CID 87874380
CID 87874380 (PubChem CID 87874380) has the molecular formula C15H20AsClN3O9S and a molecular weight of 528.78 g/mol.
| Compound Name | CID 87874380 |
|---|---|
| PubChem CID | 87874380 |
| Molecular Formula | C15H20AsClN3O9S |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 527.98 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)OCCN(CCCl)c1ccc([N+](=O)[O-])c(C(=O)[As]CCCO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20AsClN3O9S/c1-30(27,28)29-10-8-18(7-6-17)12-4-3-11(19(23)24)13(14(12)20(25)26)15(22)16-5-2-9-21/h3-4,21H,2,5-10H2,1H3 |
| InChIKey | AKMAYIGSMIWTFL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|