C13H16ClN3O9S — CID 87525103
methyl 3-[2-chloroethyl(1-methylsulfonyloxyethyl)amino]-2,6-dinitrobenzoate (PubChem CID 87525103) has the molecular formula C13H16ClN3O9S and a molecular weight of 425.80 g/mol. Its IUPAC name is methyl 3-[2-chloroethyl(1-methylsulfonyloxyethyl)amino]-2,6-dinitrobenzoate.
| Compound Name | methyl 3-[2-chloroethyl(1-methylsulfonyloxyethyl)amino]-2,6-dinitrobenzoate |
|---|---|
| PubChem CID | 87525103 |
| Molecular Formula | C13H16ClN3O9S |
| Molecular Weight | 425.80 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | methyl 3-[2-chloroethyl(1-methylsulfonyloxyethyl)amino]-2,6-dinitrobenzoate |
| SMILES | COC(=O)c1c([N+](=O)[O-])ccc(N(CCCl)C(C)OS(C)(=O)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16ClN3O9S/c1-8(26-27(3,23)24)15(7-6-14)10-5-4-9(16(19)20)11(13(18)25-2)12(10)17(21)22/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | ALYRKSXILZYOMS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.80 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|