C21H14N6O7 — CID 2775737
9-(dicyanomethylidene)-N,N-diethyl-2,5,7-trinitrofluorene-4-carboxamide (PubChem CID 2775737) has the molecular formula C21H14N6O7 and a molecular weight of 462.38 g/mol. Its IUPAC name is 9-(dicyanomethylidene)-N,N-diethyl-2,5,7-trinitrofluorene-4-carboxamide.
| Compound Name | 9-(dicyanomethylidene)-N,N-diethyl-2,5,7-trinitrofluorene-4-carboxamide |
|---|---|
| PubChem CID | 2775737 |
| Molecular Formula | C21H14N6O7 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 9-(dicyanomethylidene)-N,N-diethyl-2,5,7-trinitrofluorene-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc([N+](=O)[O-])cc2c1-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])C2=C(C#N)C#N |
| InChI | InChI=1S/C21H14N6O7/c1-3-24(4-2)21(28)16-7-12(25(29)30)5-14-18(11(9-22)10-23)15-6-13(26(31)32)8-17(27(33)34)20(15)19(14)16/h5-8H,3-4H2,1-2H3 |
| InChIKey | OWLWTZZQXPYSSK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 197.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|