C15H21N3O3 — CID 102603226
N,N-diethyl-5-nitro-2-pyrrolidin-1-ylbenzamide (PubChem CID 102603226) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N,N-diethyl-5-nitro-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N,N-diethyl-5-nitro-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 102603226 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N,N-diethyl-5-nitro-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc([N+](=O)[O-])ccc1N1CCCC1 |
| InChI | InChI=1S/C15H21N3O3/c1-3-16(4-2)15(19)13-11-12(18(20)21)7-8-14(13)17-9-5-6-10-17/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | ONCXSJZOGQDJNB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|