C17H19N3O4 — CID 31365525
N-(furan-2-ylmethyl)-N-methyl-5-nitro-2-pyrrolidin-1-ylbenzamide (PubChem CID 31365525) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-methyl-5-nitro-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-(furan-2-ylmethyl)-N-methyl-5-nitro-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 31365525 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-methyl-5-nitro-2-pyrrolidin-1-ylbenzamide |
| SMILES | CN(Cc1ccco1)C(=O)c1cc([N+](=O)[O-])ccc1N1CCCC1 |
| InChI | InChI=1S/C17H19N3O4/c1-18(12-14-5-4-10-24-14)17(21)15-11-13(20(22)23)6-7-16(15)19-8-2-3-9-19/h4-7,10-11H,2-3,8-9,12H2,1H3 |
| InChIKey | MHTKHMBFBOVTGR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|