C21H24ClN3O4 — CID 55417784
N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-5-nitro-2-piperidin-1-ylbenzamide (PubChem CID 55417784) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-5-nitro-2-piperidin-1-ylbenzamide.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-5-nitro-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55417784 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-N-methyl-5-nitro-2-piperidin-1-ylbenzamide |
| SMILES | COc1ccc(Cl)cc1CN(C)C(=O)c1cc([N+](=O)[O-])ccc1N1CCCCC1 |
| InChI | InChI=1S/C21H24ClN3O4/c1-23(14-15-12-16(22)6-9-20(15)29-2)21(26)18-13-17(25(27)28)7-8-19(18)24-10-4-3-5-11-24/h6-9,12-13H,3-5,10-11,14H2,1-2H3 |
| InChIKey | BEJUQTCHQIKBAG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|