C18H19ClN2O6 — CID 71901006
N-[(2-chloro-5-nitrophenyl)methyl]-2,4,5-trimethoxy-N-methylbenzamide (PubChem CID 71901006) has the molecular formula C18H19ClN2O6 and a molecular weight of 394.81 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)methyl]-2,4,5-trimethoxy-N-methylbenzamide.
| Compound Name | N-[(2-chloro-5-nitrophenyl)methyl]-2,4,5-trimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 71901006 |
| Molecular Formula | C18H19ClN2O6 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)methyl]-2,4,5-trimethoxy-N-methylbenzamide |
| SMILES | COc1cc(OC)c(C(=O)N(C)Cc2cc([N+](=O)[O-])ccc2Cl)cc1OC |
| InChI | InChI=1S/C18H19ClN2O6/c1-20(10-11-7-12(21(23)24)5-6-14(11)19)18(22)13-8-16(26-3)17(27-4)9-15(13)25-2/h5-9H,10H2,1-4H3 |
| InChIKey | GTDAQCVKHOWMKK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|