C16H13ClN4O7 — CID 78825891
N-[(2-chloro-5-nitrophenyl)methyl]-N,2-dimethyl-3,5-dinitrobenzamide (PubChem CID 78825891) has the molecular formula C16H13ClN4O7 and a molecular weight of 408.75 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)methyl]-N,2-dimethyl-3,5-dinitrobenzamide.
| Compound Name | N-[(2-chloro-5-nitrophenyl)methyl]-N,2-dimethyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 78825891 |
| Molecular Formula | C16H13ClN4O7 |
| Molecular Weight | 408.75 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)methyl]-N,2-dimethyl-3,5-dinitrobenzamide |
| SMILES | Cc1c(C(=O)N(C)Cc2cc([N+](=O)[O-])ccc2Cl)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13ClN4O7/c1-9-13(6-12(20(25)26)7-15(9)21(27)28)16(22)18(2)8-10-5-11(19(23)24)3-4-14(10)17/h3-7H,8H2,1-2H3 |
| InChIKey | RQGVZVNYBTZIDS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 149.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.75 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|