C15H11ClF2N2O3 — CID 51298245
N-[(2-chloro-5-nitrophenyl)methyl]-2,4-difluoro-N-methylbenzamide (PubChem CID 51298245) has the molecular formula C15H11ClF2N2O3 and a molecular weight of 340.71 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)methyl]-2,4-difluoro-N-methylbenzamide.
| Compound Name | N-[(2-chloro-5-nitrophenyl)methyl]-2,4-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 51298245 |
| Molecular Formula | C15H11ClF2N2O3 |
| Molecular Weight | 340.71 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)methyl]-2,4-difluoro-N-methylbenzamide |
| SMILES | CN(Cc1cc([N+](=O)[O-])ccc1Cl)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H11ClF2N2O3/c1-19(15(21)12-4-2-10(17)7-14(12)18)8-9-6-11(20(22)23)3-5-13(9)16/h2-7H,8H2,1H3 |
| InChIKey | HSAFXBWAZNOBIE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.71 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|