C21H20ClN3O3 — CID 18132158
N-[(2-chloro-5-nitrophenyl)methyl]-N-methyl-2-propan-2-ylquinoline-4-carboxamide (PubChem CID 18132158) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)methyl]-N-methyl-2-propan-2-ylquinoline-4-carboxamide.
| Compound Name | N-[(2-chloro-5-nitrophenyl)methyl]-N-methyl-2-propan-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 18132158 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)methyl]-N-methyl-2-propan-2-ylquinoline-4-carboxamide |
| SMILES | CC(C)c1cc(C(=O)N(C)Cc2cc([N+](=O)[O-])ccc2Cl)c2ccccc2n1 |
| InChI | InChI=1S/C21H20ClN3O3/c1-13(2)20-11-17(16-6-4-5-7-19(16)23-20)21(26)24(3)12-14-10-15(25(27)28)8-9-18(14)22/h4-11,13H,12H2,1-3H3 |
| InChIKey | SEHGKUFZFGGTJC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|