C21H20ClFN2O — CID 18209165
N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-propan-2-ylquinoline-4-carboxamide (PubChem CID 18209165) has the molecular formula C21H20ClFN2O and a molecular weight of 370.86 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-propan-2-ylquinoline-4-carboxamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-propan-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 18209165 |
| Molecular Formula | C21H20ClFN2O |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-methyl-2-propan-2-ylquinoline-4-carboxamide |
| SMILES | CC(C)c1cc(C(=O)N(C)Cc2c(F)cccc2Cl)c2ccccc2n1 |
| InChI | InChI=1S/C21H20ClFN2O/c1-13(2)20-11-15(14-7-4-5-10-19(14)24-20)21(26)25(3)12-16-17(22)8-6-9-18(16)23/h4-11,13H,12H2,1-3H3 |
| InChIKey | UQPCSSHDBIQYSI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |