C19H20ClN3O4 — CID 18080018
N-[(3-chlorophenyl)methyl]-N-methyl-2-morpholin-4-yl-5-nitrobenzamide (PubChem CID 18080018) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-N-methyl-2-morpholin-4-yl-5-nitrobenzamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-N-methyl-2-morpholin-4-yl-5-nitrobenzamide |
|---|---|
| PubChem CID | 18080018 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-N-methyl-2-morpholin-4-yl-5-nitrobenzamide |
| SMILES | CN(Cc1cccc(Cl)c1)C(=O)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C19H20ClN3O4/c1-21(13-14-3-2-4-15(20)11-14)19(24)17-12-16(23(25)26)5-6-18(17)22-7-9-27-10-8-22/h2-6,11-12H,7-10,13H2,1H3 |
| InChIKey | HHJUVKKLDRPVKD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|