C22H23N3O9 — CID 40822605
[(Z)-[(2S)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 3,4,5-trimethoxybenzoate (PubChem CID 40822605) has the molecular formula C22H23N3O9 and a molecular weight of 473.44 g/mol. Its IUPAC name is [(Z)-[(2S)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 3,4,5-trimethoxybenzoate.
| Compound Name | [(Z)-[(2S)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 40822605 |
| Molecular Formula | C22H23N3O9 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | [(Z)-[(2S)-2-(2,4-dinitrophenyl)cyclohexylidene]amino] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)O/N=C2/CCCC[C@H]2c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C22H23N3O9/c1-31-19-10-13(11-20(32-2)21(19)33-3)22(26)34-23-17-7-5-4-6-15(17)16-9-8-14(24(27)28)12-18(16)25(29)30/h8-12,15H,4-7H2,1-3H3/b23-17-/t15-/m0/s1 |
| InChIKey | LJRMRUQTCBVBOQ-ADSWHHSESA-N |
| XLogP | 4.40 |
| TPSA | 152.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|