C15H21NO4 — CID 5380531
(NE)-N-[2-(2,3,4-trimethoxyphenyl)cyclohexylidene]hydroxylamine (PubChem CID 5380531) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is (NE)-N-[2-(2,3,4-trimethoxyphenyl)cyclohexylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-(2,3,4-trimethoxyphenyl)cyclohexylidene]hydroxylamine |
|---|---|
| PubChem CID | 5380531 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (NE)-N-[2-(2,3,4-trimethoxyphenyl)cyclohexylidene]hydroxylamine |
| SMILES | COc1ccc(C2CCCC/C2=N\O)c(OC)c1OC |
| InChI | InChI=1S/C15H21NO4/c1-18-13-9-8-11(14(19-2)15(13)20-3)10-6-4-5-7-12(10)16-17/h8-10,17H,4-7H2,1-3H3/b16-12+ |
| InChIKey | QBYKOVNREREDDF-FOWTUZBSSA-N |
| XLogP | 3.20 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|