C18H19N3O7 — CID 2913010
[[1-amino-2-(4-nitrophenyl)ethylidene]amino] 3,4,5-trimethoxybenzoate (PubChem CID 2913010) has the molecular formula C18H19N3O7 and a molecular weight of 389.36 g/mol. Its IUPAC name is [[1-amino-2-(4-nitrophenyl)ethylidene]amino] 3,4,5-trimethoxybenzoate.
| Compound Name | [[1-amino-2-(4-nitrophenyl)ethylidene]amino] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2913010 |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | [[1-amino-2-(4-nitrophenyl)ethylidene]amino] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)ON=C(N)Cc2ccc([N+](=O)[O-])cc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H19N3O7/c1-25-14-9-12(10-15(26-2)17(14)27-3)18(22)28-20-16(19)8-11-4-6-13(7-5-11)21(23)24/h4-7,9-10H,8H2,1-3H3,(H2,19,20) |
| InChIKey | DOXQVDJZBMBTMB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|