C15H12IN3O4 — CID 2889574
[[1-amino-2-(4-nitrophenyl)ethylidene]amino] 3-iodobenzoate (PubChem CID 2889574) has the molecular formula C15H12IN3O4 and a molecular weight of 425.18 g/mol. Its IUPAC name is [[1-amino-2-(4-nitrophenyl)ethylidene]amino] 3-iodobenzoate.
| Compound Name | [[1-amino-2-(4-nitrophenyl)ethylidene]amino] 3-iodobenzoate |
|---|---|
| PubChem CID | 2889574 |
| Molecular Formula | C15H12IN3O4 |
| Molecular Weight | 425.18 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | [[1-amino-2-(4-nitrophenyl)ethylidene]amino] 3-iodobenzoate |
| SMILES | NC(Cc1ccc([N+](=O)[O-])cc1)=NOC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C15H12IN3O4/c16-12-3-1-2-11(9-12)15(20)23-18-14(17)8-10-4-6-13(7-5-10)19(21)22/h1-7,9H,8H2,(H2,17,18) |
| InChIKey | OKBGVPLEXFDVHF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|