C12H15NO3 — CID 82242231
2-(2-nitrophenyl)cyclohexan-1-ol (PubChem CID 82242231) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-(2-nitrophenyl)cyclohexan-1-ol.
| Compound Name | 2-(2-nitrophenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 82242231 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-(2-nitrophenyl)cyclohexan-1-ol |
| SMILES | O=[N+]([O-])c1ccccc1C1CCCCC1O |
| InChI | InChI=1S/C12H15NO3/c14-12-8-4-2-6-10(12)9-5-1-3-7-11(9)13(15)16/h1,3,5,7,10,12,14H,2,4,6,8H2 |
| InChIKey | DQHOFPRORKFGFB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|