C11H13ClO — CID 94503761
cis-(1S,2S)-2-(2-chlorophenyl)cyclopentan-1-ol (PubChem CID 94503761) has the molecular formula C11H13ClO and a molecular weight of 196.68 g/mol. Its IUPAC name is cis-(1S,2S)-2-(2-chlorophenyl)cyclopentan-1-ol.
| Compound Name | cis-(1S,2S)-2-(2-chlorophenyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 94503761 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | cis-(1S,2S)-2-(2-chlorophenyl)cyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C11H13ClO/c12-10-6-2-1-4-8(10)9-5-3-7-11(9)13/h1-2,4,6,9,11,13H,3,5,7H2/t9-,11-/m0/s1 |
| InChIKey | HSRWXLKBFCBATF-ONGXEEELSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |