C13H18O — CID 91657986
trans-(1S,2R)-2-(2,3-dimethylphenyl)cyclopentan-1-ol (PubChem CID 91657986) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is trans-(1S,2R)-2-(2,3-dimethylphenyl)cyclopentan-1-ol.
| Compound Name | trans-(1S,2R)-2-(2,3-dimethylphenyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 91657986 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | trans-(1S,2R)-2-(2,3-dimethylphenyl)cyclopentan-1-ol |
| SMILES | Cc1cccc([C@H]2CCC[C@@H]2O)c1C |
| InChI | InChI=1S/C13H18O/c1-9-5-3-6-11(10(9)2)12-7-4-8-13(12)14/h3,5-6,12-14H,4,7-8H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | OOGBVORVTHPSFW-OLZOCXBDSA-N |
| XLogP | 2.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |