C17H27N — CID 63510315
2-(2,3-dimethylphenyl)-N-propylcyclohexan-1-amine (PubChem CID 63510315) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 2-(2,3-dimethylphenyl)-N-propylcyclohexan-1-amine.
| Compound Name | 2-(2,3-dimethylphenyl)-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 63510315 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 2-(2,3-dimethylphenyl)-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1CCCCC1c1cccc(C)c1C |
| InChI | InChI=1S/C17H27N/c1-4-12-18-17-11-6-5-9-16(17)15-10-7-8-13(2)14(15)3/h7-8,10,16-18H,4-6,9,11-12H2,1-3H3 |
| InChIKey | PZPIZNXUXKWTBG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |