C9H10ClN — CID 39236190
cis-(1R,2R)-2-(2-chlorophenyl)cyclopropan-1-amine (PubChem CID 39236190) has the molecular formula C9H10ClN and a molecular weight of 167.64 g/mol. Its IUPAC name is cis-(1R,2R)-2-(2-chlorophenyl)cyclopropan-1-amine.
| Compound Name | cis-(1R,2R)-2-(2-chlorophenyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 39236190 |
| Molecular Formula | C9H10ClN |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | cis-(1R,2R)-2-(2-chlorophenyl)cyclopropan-1-amine |
| SMILES | N[C@@H]1C[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C9H10ClN/c10-8-4-2-1-3-6(8)7-5-9(7)11/h1-4,7,9H,5,11H2/t7-,9-/m1/s1 |
| InChIKey | RTSGJRWDGWWLFL-VXNVDRBHSA-N |
| XLogP | 2.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |