C11H14ClN — CID 94680134
cis-(1R,3S)-3-(2-chlorophenyl)cyclopentan-1-amine (PubChem CID 94680134) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is cis-(1R,3S)-3-(2-chlorophenyl)cyclopentan-1-amine.
| Compound Name | cis-(1R,3S)-3-(2-chlorophenyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 94680134 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | cis-(1R,3S)-3-(2-chlorophenyl)cyclopentan-1-amine |
| SMILES | N[C@@H]1CC[C@H](c2ccccc2Cl)C1 |
| InChI | InChI=1S/C11H14ClN/c12-11-4-2-1-3-10(11)8-5-6-9(13)7-8/h1-4,8-9H,5-7,13H2/t8-,9+/m0/s1 |
| InChIKey | JGMJBISFTYHCFJ-DTWKUNHWSA-N |
| XLogP | 2.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |