About N-cyclohexylcyclohexanamine;2-nitrophenol
N-cyclohexylcyclohexanamine;2-nitrophenol (PubChem CID 14647254) has the molecular formula C18H28N2O3
and a molecular weight of 320.43 g/mol. Its IUPAC name is N-cyclohexylcyclohexanamine;2-nitrophenol.
Molecular Properties
| Compound Name | N-cyclohexylcyclohexanamine;2-nitrophenol |
| PubChem CID | 14647254 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | N-cyclohexylcyclohexanamine;2-nitrophenol |
| SMILES | C1CCC(NC2CCCCC2)CC1.O=[N+]([O-])c1ccccc1O |
| InChI | InChI=1S/C12H23N.C6H5NO3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-6-4-2-1-3-5(6)7(9)10/h11-13H,1-10H2;1-4,8H |
| InChIKey | SMWYHBWSQMJGEE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexylcyclohexanamine;2-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylcyclohexanamine;2-nitrophenol?
The IUPAC name of N-cyclohexylcyclohexanamine;2-nitrophenol (CID 14647254) is N-cyclohexylcyclohexanamine;2-nitrophenol.
What is the SMILES notation for N-cyclohexylcyclohexanamine;2-nitrophenol?
The canonical SMILES for N-cyclohexylcyclohexanamine;2-nitrophenol is C1CCC(NC2CCCCC2)CC1.O=[N+]([O-])c1ccccc1O.
What is the InChIKey of N-cyclohexylcyclohexanamine;2-nitrophenol?
The InChIKey is SMWYHBWSQMJGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.C6H5NO3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-6-4-2-1-3-5(6)7(9)10/h11-13H,1-10H2;1-4,8H.
What are the key properties of N-cyclohexylcyclohexanamine;2-nitrophenol?
N-cyclohexylcyclohexanamine;2-nitrophenol has a molecular weight of 320.43 g/mol, XLogP of 4.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylcyclohexanamine;2-nitrophenol is sourced from PubChem (CID 14647254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).