About formamide;2-nitrophenol
formamide;2-nitrophenol (PubChem CID 20538790) has the molecular formula C7H8N2O4
and a molecular weight of 184.15 g/mol. Its IUPAC name is formamide;2-nitrophenol.
Molecular Properties
| Compound Name | formamide;2-nitrophenol |
| PubChem CID | 20538790 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | formamide;2-nitrophenol |
| SMILES | NC=O.O=[N+]([O-])c1ccccc1O |
| InChI | InChI=1S/C6H5NO3.CH3NO/c8-6-4-2-1-3-5(6)7(9)10;2-1-3/h1-4,8H;1H,(H2,2,3) |
| InChIKey | CPIGQRQONZEGDZ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formamide;2-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamide;2-nitrophenol?
The IUPAC name of formamide;2-nitrophenol (CID 20538790) is formamide;2-nitrophenol.
What is the SMILES notation for formamide;2-nitrophenol?
The canonical SMILES for formamide;2-nitrophenol is NC=O.O=[N+]([O-])c1ccccc1O.
What is the InChIKey of formamide;2-nitrophenol?
The InChIKey is CPIGQRQONZEGDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO3.CH3NO/c8-6-4-2-1-3-5(6)7(9)10;2-1-3/h1-4,8H;1H,(H2,2,3).
What are the key properties of formamide;2-nitrophenol?
formamide;2-nitrophenol has a molecular weight of 184.15 g/mol, XLogP of 0.40, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formamide;2-nitrophenol is sourced from PubChem (CID 20538790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).